C15H21BrN2O3SSi — CID 170650358
3-bromo-4-methyl-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]thiophene-2-carboxylic acid (PubChem CID 170650358) has the molecular formula C15H21BrN2O3SSi and a molecular weight of 417.40 g/mol. Its IUPAC name is 3-bromo-4-methyl-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]thiophene-2-carboxylic acid.
| Compound Name | 3-bromo-4-methyl-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 170650358 |
| Molecular Formula | C15H21BrN2O3SSi |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 3-bromo-4-methyl-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]thiophene-2-carboxylic acid |
| SMILES | Cc1c(-c2cnn(COCC[Si](C)(C)C)c2)sc(C(=O)O)c1Br |
| InChI | InChI=1S/C15H21BrN2O3SSi/c1-10-12(16)14(15(19)20)22-13(10)11-7-17-18(8-11)9-21-5-6-23(2,3)4/h7-8H,5-6,9H2,1-4H3,(H,19,20) |
| InChIKey | NQYHKWXGUHYPTH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|