C22H30N2O4SSi — CID 175826221
1-(methoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6,7,8,9-tetrahydrothieno[2,3-c]chromen-4-one (PubChem CID 175826221) has the molecular formula C22H30N2O4SSi and a molecular weight of 446.65 g/mol. Its IUPAC name is 1-(methoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6,7,8,9-tetrahydrothieno[2,3-c]chromen-4-one.
| Compound Name | 1-(methoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6,7,8,9-tetrahydrothieno[2,3-c]chromen-4-one |
|---|---|
| PubChem CID | 175826221 |
| Molecular Formula | C22H30N2O4SSi |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-(methoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6,7,8,9-tetrahydrothieno[2,3-c]chromen-4-one |
| SMILES | COCc1c(-c2cnn(COCC[Si](C)(C)C)c2)sc2c(=O)oc3c(c12)CCCC3 |
| InChI | InChI=1S/C22H30N2O4SSi/c1-26-13-17-19-16-7-5-6-8-18(16)28-22(25)21(19)29-20(17)15-11-23-24(12-15)14-27-9-10-30(2,3)4/h11-12H,5-10,13-14H2,1-4H3 |
| InChIKey | VYXZAOLRTXCCJT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|