C28H32F2N2O5SSi — CID 174242436
8,8-difluoro-6-(methoxymethyl)-6-phenoxy-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydrothieno[2,3-c]chromen-4-one (PubChem CID 174242436) has the molecular formula C28H32F2N2O5SSi and a molecular weight of 574.72 g/mol. Its IUPAC name is 8,8-difluoro-6-(methoxymethyl)-6-phenoxy-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydrothieno[2,3-c]chromen-4-one.
| Compound Name | 8,8-difluoro-6-(methoxymethyl)-6-phenoxy-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydrothieno[2,3-c]chromen-4-one |
|---|---|
| PubChem CID | 174242436 |
| Molecular Formula | C28H32F2N2O5SSi |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 8,8-difluoro-6-(methoxymethyl)-6-phenoxy-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydrothieno[2,3-c]chromen-4-one |
| SMILES | COCC1(Oc2ccccc2)CC(F)(F)Cc2c1oc(=O)c1sc(-c3cnn(COCC[Si](C)(C)C)c3)cc21 |
| InChI | InChI=1S/C28H32F2N2O5SSi/c1-34-17-27(37-20-8-6-5-7-9-20)16-28(29,30)13-22-21-12-23(38-24(21)26(33)36-25(22)27)19-14-31-32(15-19)18-35-10-11-39(2,3)4/h5-9,12,14-15H,10-11,13,16-18H2,1-4H3 |
| InChIKey | UEJAFYYRCPRYAE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|