C20H24F3N3O2SSi — CID 165135525
1,8,8-trifluoro-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5,6,7,9-tetrahydrothieno[2,3-c]quinolin-4-one (PubChem CID 165135525) has the molecular formula C20H24F3N3O2SSi and a molecular weight of 455.58 g/mol. Its IUPAC name is 1,8,8-trifluoro-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5,6,7,9-tetrahydrothieno[2,3-c]quinolin-4-one.
| Compound Name | 1,8,8-trifluoro-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5,6,7,9-tetrahydrothieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 165135525 |
| Molecular Formula | C20H24F3N3O2SSi |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1,8,8-trifluoro-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5,6,7,9-tetrahydrothieno[2,3-c]quinolin-4-one |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2sc3c(=O)[nH]c4c(c3c2F)CC(F)(F)CC4)cn1 |
| InChI | InChI=1S/C20H24F3N3O2SSi/c1-30(2,3)7-6-28-11-26-10-12(9-24-26)17-16(21)15-13-8-20(22,23)5-4-14(13)25-19(27)18(15)29-17/h9-10H,4-8,11H2,1-3H3,(H,25,27) |
| InChIKey | CLSGKHBFSLWHTR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|