C21H26F2N2O3SSi — CID 175826196
8,8-difluoro-6-methyl-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydro-6H-thieno[2,3-c]chromen-4-one (PubChem CID 175826196) has the molecular formula C21H26F2N2O3SSi and a molecular weight of 452.60 g/mol. Its IUPAC name is 8,8-difluoro-6-methyl-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydro-6H-thieno[2,3-c]chromen-4-one.
| Compound Name | 8,8-difluoro-6-methyl-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydro-6H-thieno[2,3-c]chromen-4-one |
|---|---|
| PubChem CID | 175826196 |
| Molecular Formula | C21H26F2N2O3SSi |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 8,8-difluoro-6-methyl-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-7,9-dihydro-6H-thieno[2,3-c]chromen-4-one |
| SMILES | CC1CC(F)(F)Cc2c1oc(=O)c1sc(-c3cnn(COCC[Si](C)(C)C)c3)cc21 |
| InChI | InChI=1S/C21H26F2N2O3SSi/c1-13-8-21(22,23)9-16-15-7-17(29-19(15)20(26)28-18(13)16)14-10-24-25(11-14)12-27-5-6-30(2,3)4/h7,10-11,13H,5-6,8-9,12H2,1-4H3 |
| InChIKey | PXXIOMXICFHLJT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|