C26H38BrN5O4Si — CID 168945681
tert-butyl 7-[6-[[3-bromo-4-carbamoyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]-3-pyridinyl]hept-6-ynoate (PubChem CID 168945681) has the molecular formula C26H38BrN5O4Si and a molecular weight of 592.61 g/mol. Its IUPAC name is tert-butyl 7-[6-[[3-bromo-4-carbamoyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]-3-pyridinyl]hept-6-ynoate.
| Compound Name | tert-butyl 7-[6-[[3-bromo-4-carbamoyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]-3-pyridinyl]hept-6-ynoate |
|---|---|
| PubChem CID | 168945681 |
| Molecular Formula | C26H38BrN5O4Si |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | tert-butyl 7-[6-[[3-bromo-4-carbamoyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]-3-pyridinyl]hept-6-ynoate |
| SMILES | CC(C)(C)OC(=O)CCCCC#Cc1ccc(Nc2c(C(N)=O)c(Br)nn2COCC[Si](C)(C)C)nc1 |
| InChI | InChI=1S/C26H38BrN5O4Si/c1-26(2,3)36-21(33)12-10-8-7-9-11-19-13-14-20(29-17-19)30-25-22(24(28)34)23(27)31-32(25)18-35-15-16-37(4,5)6/h13-14,17H,7-8,10,12,15-16,18H2,1-6H3,(H2,28,34)(H,29,30) |
| InChIKey | AUQPZKLEOGTUNT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|