C23H27NO5S — CID 162776481
tert-butyl 6-[4-[(4-sulfamoylphenoxy)methyl]phenyl]hex-5-ynoate (PubChem CID 162776481) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is tert-butyl 6-[4-[(4-sulfamoylphenoxy)methyl]phenyl]hex-5-ynoate.
| Compound Name | tert-butyl 6-[4-[(4-sulfamoylphenoxy)methyl]phenyl]hex-5-ynoate |
|---|---|
| PubChem CID | 162776481 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | tert-butyl 6-[4-[(4-sulfamoylphenoxy)methyl]phenyl]hex-5-ynoate |
| SMILES | CC(C)(C)OC(=O)CCCC#Cc1ccc(COc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C23H27NO5S/c1-23(2,3)29-22(25)8-6-4-5-7-18-9-11-19(12-10-18)17-28-20-13-15-21(16-14-20)30(24,26)27/h9-16H,4,6,8,17H2,1-3H3,(H2,24,26,27) |
| InChIKey | OKBZWZIDVPAOAI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|