C29H43NO5S — CID 147429719
tert-butyl 2,2,4,4-tetramethyl-8-[4-[(4-sulfamoylphenoxy)methyl]phenyl]octanoate (PubChem CID 147429719) has the molecular formula C29H43NO5S and a molecular weight of 517.73 g/mol. Its IUPAC name is tert-butyl 2,2,4,4-tetramethyl-8-[4-[(4-sulfamoylphenoxy)methyl]phenyl]octanoate.
| Compound Name | tert-butyl 2,2,4,4-tetramethyl-8-[4-[(4-sulfamoylphenoxy)methyl]phenyl]octanoate |
|---|---|
| PubChem CID | 147429719 |
| Molecular Formula | C29H43NO5S |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | tert-butyl 2,2,4,4-tetramethyl-8-[4-[(4-sulfamoylphenoxy)methyl]phenyl]octanoate |
| SMILES | CC(C)(CCCCc1ccc(COc2ccc(S(N)(=O)=O)cc2)cc1)CC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H43NO5S/c1-27(2,3)35-26(31)29(6,7)21-28(4,5)19-9-8-10-22-11-13-23(14-12-22)20-34-24-15-17-25(18-16-24)36(30,32)33/h11-18H,8-10,19-21H2,1-7H3,(H2,30,32,33) |
| InChIKey | DUCABUXXTHGTRX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|