C28H39NO5S — CID 170650732
tert-butyl 12-[4-(4-sulfamoylphenoxy)phenyl]dodec-2-enoate (PubChem CID 170650732) has the molecular formula C28H39NO5S and a molecular weight of 501.69 g/mol. Its IUPAC name is tert-butyl 12-[4-(4-sulfamoylphenoxy)phenyl]dodec-2-enoate.
| Compound Name | tert-butyl 12-[4-(4-sulfamoylphenoxy)phenyl]dodec-2-enoate |
|---|---|
| PubChem CID | 170650732 |
| Molecular Formula | C28H39NO5S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | tert-butyl 12-[4-(4-sulfamoylphenoxy)phenyl]dodec-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=CCCCCCCCCCc1ccc(Oc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C28H39NO5S/c1-28(2,3)34-27(30)14-12-10-8-6-4-5-7-9-11-13-23-15-17-24(18-16-23)33-25-19-21-26(22-20-25)35(29,31)32/h12,14-22H,4-11,13H2,1-3H3,(H2,29,31,32) |
| InChIKey | QENUNDWFLPWVIP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|