C28H37NO5S — CID 177304673
tert-butyl 10-[4-[2-(4-sulfamoylphenoxy)ethyl]phenyl]dec-9-ynoate (PubChem CID 177304673) has the molecular formula C28H37NO5S and a molecular weight of 499.67 g/mol. Its IUPAC name is tert-butyl 10-[4-[2-(4-sulfamoylphenoxy)ethyl]phenyl]dec-9-ynoate.
| Compound Name | tert-butyl 10-[4-[2-(4-sulfamoylphenoxy)ethyl]phenyl]dec-9-ynoate |
|---|---|
| PubChem CID | 177304673 |
| Molecular Formula | C28H37NO5S |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | tert-butyl 10-[4-[2-(4-sulfamoylphenoxy)ethyl]phenyl]dec-9-ynoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCCC#Cc1ccc(CCOc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C28H37NO5S/c1-28(2,3)34-27(30)12-10-8-6-4-5-7-9-11-23-13-15-24(16-14-23)21-22-33-25-17-19-26(20-18-25)35(29,31)32/h13-20H,4-8,10,12,21-22H2,1-3H3,(H2,29,31,32) |
| InChIKey | GAYALNFXGXWMKB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|