C28H36FNO5S — CID 177304674
tert-butyl 12-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]dodec-11-ynoate (PubChem CID 177304674) has the molecular formula C28H36FNO5S and a molecular weight of 517.66 g/mol. Its IUPAC name is tert-butyl 12-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]dodec-11-ynoate.
| Compound Name | tert-butyl 12-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]dodec-11-ynoate |
|---|---|
| PubChem CID | 177304674 |
| Molecular Formula | C28H36FNO5S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | tert-butyl 12-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]dodec-11-ynoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCCC#Cc1cc(Oc2ccc(S(N)(=O)=O)cc2)ccc1F |
| InChI | InChI=1S/C28H36FNO5S/c1-28(2,3)35-27(31)14-12-10-8-6-4-5-7-9-11-13-22-21-24(17-20-26(22)29)34-23-15-18-25(19-16-23)36(30,32)33/h15-21H,4-10,12,14H2,1-3H3,(H2,30,32,33) |
| InChIKey | SXBFXBCADZXRDI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|