C31H38FN3O7S — CID 170650751
2-[[4-[4-fluoro-3-[10-[(2-methylpropan-2-yl)oxy]-10-oxodecyl]phenoxy]phenyl]sulfonylamino]pyrimidine-5-carboxylic acid (PubChem CID 170650751) has the molecular formula C31H38FN3O7S and a molecular weight of 615.72 g/mol. Its IUPAC name is 2-[[4-[4-fluoro-3-[10-[(2-methylpropan-2-yl)oxy]-10-oxodecyl]phenoxy]phenyl]sulfonylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[[4-[4-fluoro-3-[10-[(2-methylpropan-2-yl)oxy]-10-oxodecyl]phenoxy]phenyl]sulfonylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 170650751 |
| Molecular Formula | C31H38FN3O7S |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 2-[[4-[4-fluoro-3-[10-[(2-methylpropan-2-yl)oxy]-10-oxodecyl]phenoxy]phenyl]sulfonylamino]pyrimidine-5-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCCc1cc(Oc2ccc(S(=O)(=O)Nc3ncc(C(=O)O)cn3)cc2)ccc1F |
| InChI | InChI=1S/C31H38FN3O7S/c1-31(2,3)42-28(36)12-10-8-6-4-5-7-9-11-22-19-25(15-18-27(22)32)41-24-13-16-26(17-14-24)43(39,40)35-30-33-20-23(21-34-30)29(37)38/h13-21H,4-12H2,1-3H3,(H,37,38)(H,33,34,35) |
| InChIKey | CUXJXZAHEQGWIJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|