C58H65F2N3O14S3 — CID 163747598
bis(tert-butyl 6-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]hex-5-ynoate);tert-butyl 4-(4-sulfamoylphenyl)but-3-ynoate (PubChem CID 163747598) has the molecular formula C58H65F2N3O14S3 and a molecular weight of 1162.36 g/mol. Its IUPAC name is bis(tert-butyl 6-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]hex-5-ynoate);tert-butyl 4-(4-sulfamoylphenyl)but-3-ynoate.
| Compound Name | bis(tert-butyl 6-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]hex-5-ynoate);tert-butyl 4-(4-sulfamoylphenyl)but-3-ynoate |
|---|---|
| PubChem CID | 163747598 |
| Molecular Formula | C58H65F2N3O14S3 |
| Molecular Weight | 1162.36 g/mol |
| Exact Mass | 1161.36 |
| IUPAC Name | bis(tert-butyl 6-[2-fluoro-5-(4-sulfamoylphenoxy)phenyl]hex-5-ynoate);tert-butyl 4-(4-sulfamoylphenyl)but-3-ynoate |
| SMILES | CC(C)(C)OC(=O)CC#Cc1ccc(S(N)(=O)=O)cc1.CC(C)(C)OC(=O)CCCC#Cc1cc(Oc2ccc(S(N)(=O)=O)cc2)ccc1F.CC(C)(C)OC(=O)CCCC#Cc1cc(Oc2ccc(S(N)(=O)=O)cc2)ccc1F |
| InChI | InChI=1S/2C22H24FNO5S.C14H17NO4S/c2*1-22(2,3)29-21(25)8-6-4-5-7-16-15-18(11-14-20(16)23)28-17-9-12-19(13-10-17)30(24,26)27;1-14(2,3)19-13(16)6-4-5-11-7-9-12(10-8-11)20(15,17)18/h2*9-15H,4,6,8H2,1-3H3,(H2,24,26,27);7-10H,6H2,1-3H3,(H2,15,17,18) |
| InChIKey | LNEWUNSUSINSBW-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 277.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1162.36 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|