C28H38N6O4 — CID 168945984
tert-butyl 5-[[4-[[3-(4-aminophenyl)-1-tert-butyl-4-carbamoylpyrazol-5-yl]amino]-2-pyridinyl]oxy]pentanoate (PubChem CID 168945984) has the molecular formula C28H38N6O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is tert-butyl 5-[[4-[[3-(4-aminophenyl)-1-tert-butyl-4-carbamoylpyrazol-5-yl]amino]-2-pyridinyl]oxy]pentanoate.
| Compound Name | tert-butyl 5-[[4-[[3-(4-aminophenyl)-1-tert-butyl-4-carbamoylpyrazol-5-yl]amino]-2-pyridinyl]oxy]pentanoate |
|---|---|
| PubChem CID | 168945984 |
| Molecular Formula | C28H38N6O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | tert-butyl 5-[[4-[[3-(4-aminophenyl)-1-tert-butyl-4-carbamoylpyrazol-5-yl]amino]-2-pyridinyl]oxy]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCOc1cc(Nc2c(C(N)=O)c(-c3ccc(N)cc3)nn2C(C)(C)C)ccn1 |
| InChI | InChI=1S/C28H38N6O4/c1-27(2,3)34-26(23(25(30)36)24(33-34)18-10-12-19(29)13-11-18)32-20-14-15-31-21(17-20)37-16-8-7-9-22(35)38-28(4,5)6/h10-15,17H,7-9,16,29H2,1-6H3,(H2,30,36)(H,31,32) |
| InChIKey | QCYAADVOAUFNHT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|