C18H27NO5 — CID 176683313
2-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]pyridine-3-carboxylic acid (PubChem CID 176683313) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]pyridine-3-carboxylic acid.
| Compound Name | 2-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 176683313 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CCCCCCCOc1ncccc1C(=O)O |
| InChI | InChI=1S/C18H27NO5/c1-18(2,3)24-15(20)11-7-5-4-6-8-13-23-16-14(17(21)22)10-9-12-19-16/h9-10,12H,4-8,11,13H2,1-3H3,(H,21,22) |
| InChIKey | IPLWKFNJLYFSNL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|