C19H24O5 — CID 175898390
3-ethynyl-2-methyl-4-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]benzoic acid (PubChem CID 175898390) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-ethynyl-2-methyl-4-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]benzoic acid.
| Compound Name | 3-ethynyl-2-methyl-4-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]benzoic acid |
|---|---|
| PubChem CID | 175898390 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-ethynyl-2-methyl-4-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]benzoic acid |
| SMILES | C#Cc1c(OCCCCC(=O)OC(C)(C)C)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C19H24O5/c1-6-14-13(2)15(18(21)22)10-11-16(14)23-12-8-7-9-17(20)24-19(3,4)5/h1,10-11H,7-9,12H2,2-5H3,(H,21,22) |
| InChIKey | JHVWUWAPRMOXJY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|