C25H33N5O3S — CID 166905173
1-tert-butyl-3-[4-[ethylsulfanyl(methyl)amino]phenyl]-5-[[2-(2-methoxyethoxy)-4-pyridinyl]amino]pyrazole-4-carbaldehyde (PubChem CID 166905173) has the molecular formula C25H33N5O3S and a molecular weight of 483.64 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-[ethylsulfanyl(methyl)amino]phenyl]-5-[[2-(2-methoxyethoxy)-4-pyridinyl]amino]pyrazole-4-carbaldehyde.
| Compound Name | 1-tert-butyl-3-[4-[ethylsulfanyl(methyl)amino]phenyl]-5-[[2-(2-methoxyethoxy)-4-pyridinyl]amino]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 166905173 |
| Molecular Formula | C25H33N5O3S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 1-tert-butyl-3-[4-[ethylsulfanyl(methyl)amino]phenyl]-5-[[2-(2-methoxyethoxy)-4-pyridinyl]amino]pyrazole-4-carbaldehyde |
| SMILES | CCSN(C)c1ccc(-c2nn(C(C)(C)C)c(Nc3ccnc(OCCOC)c3)c2C=O)cc1 |
| InChI | InChI=1S/C25H33N5O3S/c1-7-34-29(5)20-10-8-18(9-11-20)23-21(17-31)24(30(28-23)25(2,3)4)27-19-12-13-26-22(16-19)33-15-14-32-6/h8-13,16-17H,7,14-15H2,1-6H3,(H,26,27) |
| InChIKey | DCQCSNCPWWEXDW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|