C22H31N7OS — CID 168945798
1-tert-butyl-3-[4-(ethylsulfanylamino)phenyl]-5-[(6-methylpyrazin-2-yl)amino]pyrazole-4-carbaldehyde;methanamine (PubChem CID 168945798) has the molecular formula C22H31N7OS and a molecular weight of 441.61 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-(ethylsulfanylamino)phenyl]-5-[(6-methylpyrazin-2-yl)amino]pyrazole-4-carbaldehyde;methanamine.
| Compound Name | 1-tert-butyl-3-[4-(ethylsulfanylamino)phenyl]-5-[(6-methylpyrazin-2-yl)amino]pyrazole-4-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 168945798 |
| Molecular Formula | C22H31N7OS |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-tert-butyl-3-[4-(ethylsulfanylamino)phenyl]-5-[(6-methylpyrazin-2-yl)amino]pyrazole-4-carbaldehyde;methanamine |
| SMILES | CCSNc1ccc(-c2nn(C(C)(C)C)c(Nc3cncc(C)n3)c2C=O)cc1.CN |
| InChI | InChI=1S/C21H26N6OS.CH5N/c1-6-29-26-16-9-7-15(8-10-16)19-17(13-28)20(27(25-19)21(3,4)5)24-18-12-22-11-14(2)23-18;1-2/h7-13,26H,6H2,1-5H3,(H,23,24);2H2,1H3 |
| InChIKey | OHDDDHAJORTLHH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|