C28H34N6O5 — CID 168945494
tert-butyl 5-[[4-[[1-tert-butyl-4-cyano-3-(4-nitrophenyl)pyrazol-5-yl]amino]-3-pyridinyl]oxy]pentanoate (PubChem CID 168945494) has the molecular formula C28H34N6O5 and a molecular weight of 534.62 g/mol. Its IUPAC name is tert-butyl 5-[[4-[[1-tert-butyl-4-cyano-3-(4-nitrophenyl)pyrazol-5-yl]amino]-3-pyridinyl]oxy]pentanoate.
| Compound Name | tert-butyl 5-[[4-[[1-tert-butyl-4-cyano-3-(4-nitrophenyl)pyrazol-5-yl]amino]-3-pyridinyl]oxy]pentanoate |
|---|---|
| PubChem CID | 168945494 |
| Molecular Formula | C28H34N6O5 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | tert-butyl 5-[[4-[[1-tert-butyl-4-cyano-3-(4-nitrophenyl)pyrazol-5-yl]amino]-3-pyridinyl]oxy]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCOc1cnccc1Nc1c(C#N)c(-c2ccc([N+](=O)[O-])cc2)nn1C(C)(C)C |
| InChI | InChI=1S/C28H34N6O5/c1-27(2,3)33-26(21(17-29)25(32-33)19-10-12-20(13-11-19)34(36)37)31-22-14-15-30-18-23(22)38-16-8-7-9-24(35)39-28(4,5)6/h10-15,18H,7-9,16H2,1-6H3,(H,30,31) |
| InChIKey | PYSZCJBHHXMZBT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|