C20H29NO5Si — CID 160623868
methyl (2S)-1-[2-methyl-6-(2-trimethylsilylethoxymethoxy)benzoyl]-2,3-dihydropyrrole-2-carboxylate (PubChem CID 160623868) has the molecular formula C20H29NO5Si and a molecular weight of 391.54 g/mol. Its IUPAC name is methyl (2S)-1-[2-methyl-6-(2-trimethylsilylethoxymethoxy)benzoyl]-2,3-dihydropyrrole-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-methyl-6-(2-trimethylsilylethoxymethoxy)benzoyl]-2,3-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 160623868 |
| Molecular Formula | C20H29NO5Si |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | methyl (2S)-1-[2-methyl-6-(2-trimethylsilylethoxymethoxy)benzoyl]-2,3-dihydropyrrole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=CN1C(=O)c1c(C)cccc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C20H29NO5Si/c1-15-8-6-10-17(26-14-25-12-13-27(3,4)5)18(15)19(22)21-11-7-9-16(21)20(23)24-2/h6-8,10-11,16H,9,12-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | DUNLASQEGWRQOQ-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|