C23H28O8Si — CID 10742636
methyl 1,8-dimethoxy-9-oxo-3-(2-trimethylsilylethoxymethoxy)xanthene-4-carboxylate (PubChem CID 10742636) has the molecular formula C23H28O8Si and a molecular weight of 460.56 g/mol. Its IUPAC name is methyl 1,8-dimethoxy-9-oxo-3-(2-trimethylsilylethoxymethoxy)xanthene-4-carboxylate.
| Compound Name | methyl 1,8-dimethoxy-9-oxo-3-(2-trimethylsilylethoxymethoxy)xanthene-4-carboxylate |
|---|---|
| PubChem CID | 10742636 |
| Molecular Formula | C23H28O8Si |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl 1,8-dimethoxy-9-oxo-3-(2-trimethylsilylethoxymethoxy)xanthene-4-carboxylate |
| SMILES | COC(=O)c1c(OCOCC[Si](C)(C)C)cc(OC)c2c(=O)c3c(OC)cccc3oc12 |
| InChI | InChI=1S/C23H28O8Si/c1-26-14-8-7-9-15-18(14)21(24)19-16(27-2)12-17(20(22(19)31-15)23(25)28-3)30-13-29-10-11-32(4,5)6/h7-9,12H,10-11,13H2,1-6H3 |
| InChIKey | HCCJSNHYDKNVIA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|