C19H24N2O3Si — CID 142676475
7-(2-trimethylsilylethoxymethoxy)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 142676475) has the molecular formula C19H24N2O3Si and a molecular weight of 356.50 g/mol. Its IUPAC name is 7-(2-trimethylsilylethoxymethoxy)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 7-(2-trimethylsilylethoxymethoxy)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 142676475 |
| Molecular Formula | C19H24N2O3Si |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 7-(2-trimethylsilylethoxymethoxy)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | C[Si](C)(C)CCOCOc1cccc2c1C(=O)Nc1ccccc1N2 |
| InChI | InChI=1S/C19H24N2O3Si/c1-25(2,3)12-11-23-13-24-17-10-6-9-16-18(17)19(22)21-15-8-5-4-7-14(15)20-16/h4-10,20H,11-13H2,1-3H3,(H,21,22) |
| InChIKey | DKQUJENVXVBSKU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|