C16H12O7 — CID 170989946
methyl 3,8-dihydroxy-2-methoxy-9-oxoxanthene-1-carboxylate (PubChem CID 170989946) has the molecular formula C16H12O7 and a molecular weight of 316.27 g/mol. Its IUPAC name is methyl 3,8-dihydroxy-2-methoxy-9-oxoxanthene-1-carboxylate.
| Compound Name | methyl 3,8-dihydroxy-2-methoxy-9-oxoxanthene-1-carboxylate |
|---|---|
| PubChem CID | 170989946 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | methyl 3,8-dihydroxy-2-methoxy-9-oxoxanthene-1-carboxylate |
| SMILES | COC(=O)c1c(OC)c(O)cc2oc3cccc(O)c3c(=O)c12 |
| InChI | InChI=1S/C16H12O7/c1-21-15-8(18)6-10-12(13(15)16(20)22-2)14(19)11-7(17)4-3-5-9(11)23-10/h3-6,17-18H,1-2H3 |
| InChIKey | KZFSGNATANMFDH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|