C31H45NO9Si — CID 160690564
methyl 4-(3-aminocyclobutyl)oxy-3-hydroxybenzoate;methyl 4-(3-methylcyclobutyl)oxy-3-(2-trimethylsilylethoxymethoxy)benzoate (PubChem CID 160690564) has the molecular formula C31H45NO9Si and a molecular weight of 603.79 g/mol. Its IUPAC name is methyl 4-(3-aminocyclobutyl)oxy-3-hydroxybenzoate;methyl 4-(3-methylcyclobutyl)oxy-3-(2-trimethylsilylethoxymethoxy)benzoate.
| Compound Name | methyl 4-(3-aminocyclobutyl)oxy-3-hydroxybenzoate;methyl 4-(3-methylcyclobutyl)oxy-3-(2-trimethylsilylethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 160690564 |
| Molecular Formula | C31H45NO9Si |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | methyl 4-(3-aminocyclobutyl)oxy-3-hydroxybenzoate;methyl 4-(3-methylcyclobutyl)oxy-3-(2-trimethylsilylethoxymethoxy)benzoate |
| SMILES | COC(=O)c1ccc(OC2CC(C)C2)c(OCOCC[Si](C)(C)C)c1.COC(=O)c1ccc(OC2CC(N)C2)c(O)c1 |
| InChI | InChI=1S/C19H30O5Si.C12H15NO4/c1-14-10-16(11-14)24-17-7-6-15(19(20)21-2)12-18(17)23-13-22-8-9-25(3,4)5;1-16-12(15)7-2-3-11(10(14)4-7)17-9-5-8(13)6-9/h6-7,12,14,16H,8-11,13H2,1-5H3;2-4,8-9,14H,5-6,13H2,1H3 |
| InChIKey | RPISQQCKPRUISI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|