C16H23NO2S — CID 64737082
4-(3,5-dimethylcyclohexyl)oxy-3-methoxybenzenecarbothioamide (PubChem CID 64737082) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 4-(3,5-dimethylcyclohexyl)oxy-3-methoxybenzenecarbothioamide.
| Compound Name | 4-(3,5-dimethylcyclohexyl)oxy-3-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 64737082 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-(3,5-dimethylcyclohexyl)oxy-3-methoxybenzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)ccc1OC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C16H23NO2S/c1-10-6-11(2)8-13(7-10)19-14-5-4-12(16(17)20)9-15(14)18-3/h4-5,9-11,13H,6-8H2,1-3H3,(H2,17,20) |
| InChIKey | BVVKGIRLVZLLRW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|