C17H25NO2S — CID 65344197
5-[(3,5-dimethylcyclohexyl)oxymethyl]-2-methoxybenzenecarbothioamide (PubChem CID 65344197) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 5-[(3,5-dimethylcyclohexyl)oxymethyl]-2-methoxybenzenecarbothioamide.
| Compound Name | 5-[(3,5-dimethylcyclohexyl)oxymethyl]-2-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 65344197 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 5-[(3,5-dimethylcyclohexyl)oxymethyl]-2-methoxybenzenecarbothioamide |
| SMILES | COc1ccc(COC2CC(C)CC(C)C2)cc1C(N)=S |
| InChI | InChI=1S/C17H25NO2S/c1-11-6-12(2)8-14(7-11)20-10-13-4-5-16(19-3)15(9-13)17(18)21/h4-5,9,11-12,14H,6-8,10H2,1-3H3,(H2,18,21) |
| InChIKey | KABICCVATZVLML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|