C16H23NOS — CID 64728595
2-[(3,5-dimethylcyclohexyl)oxymethyl]benzenecarbothioamide (PubChem CID 64728595) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 2-[(3,5-dimethylcyclohexyl)oxymethyl]benzenecarbothioamide.
| Compound Name | 2-[(3,5-dimethylcyclohexyl)oxymethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64728595 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[(3,5-dimethylcyclohexyl)oxymethyl]benzenecarbothioamide |
| SMILES | CC1CC(C)CC(OCc2ccccc2C(N)=S)C1 |
| InChI | InChI=1S/C16H23NOS/c1-11-7-12(2)9-14(8-11)18-10-13-5-3-4-6-15(13)16(17)19/h3-6,11-12,14H,7-10H2,1-2H3,(H2,17,19) |
| InChIKey | HAYSYGRKDCSXDV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|