About methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate
methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate (PubChem CID 157341662) has the molecular formula C16H16ClN3O2
and a molecular weight of 317.78 g/mol. Its IUPAC name is methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate.
Molecular Properties
| Compound Name | methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate |
| PubChem CID | 157341662 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate |
| SMILES | C.COC(=O)c1ccc2c(-c3ccnc(Cl)n3)cn(C)c2c1 |
| InChI | InChI=1S/C15H12ClN3O2.CH4/c1-19-8-11(12-5-6-17-15(16)18-12)10-4-3-9(7-13(10)19)14(20)21-2;/h3-8H,1-2H3;1H4 |
| InChIKey | BGLVPWYVZWKFJA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate?
The IUPAC name of methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate (CID 157341662) is methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate.
What is the SMILES notation for methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate?
The canonical SMILES for methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate is C.COC(=O)c1ccc2c(-c3ccnc(Cl)n3)cn(C)c2c1.
What is the InChIKey of methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate?
The InChIKey is BGLVPWYVZWKFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN3O2.CH4/c1-19-8-11(12-5-6-17-15(16)18-12)10-4-3-9(7-13(10)19)14(20)21-2;/h3-8H,1-2H3;1H4.
What are the key properties of methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate?
methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate has a molecular weight of 317.78 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 3-(2-chloropyrimidin-4-yl)-1-methylindole-6-carboxylate is sourced from PubChem (CID 157341662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).