C15H12ClN3O2 — CID 130205810
2-[4-(2-chloropyrimidin-4-yl)-1-methylindol-6-yl]acetic acid (PubChem CID 130205810) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is 2-[4-(2-chloropyrimidin-4-yl)-1-methylindol-6-yl]acetic acid.
| Compound Name | 2-[4-(2-chloropyrimidin-4-yl)-1-methylindol-6-yl]acetic acid |
|---|---|
| PubChem CID | 130205810 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[4-(2-chloropyrimidin-4-yl)-1-methylindol-6-yl]acetic acid |
| SMILES | Cn1ccc2c(-c3ccnc(Cl)n3)cc(CC(=O)O)cc21 |
| InChI | InChI=1S/C15H12ClN3O2/c1-19-5-3-10-11(12-2-4-17-15(16)18-12)6-9(7-13(10)19)8-14(20)21/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | SMASSTYFQMFOLP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |