C18H32N4O2Si — CID 165175430
2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol (PubChem CID 165175430) has the molecular formula C18H32N4O2Si and a molecular weight of 364.57 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol.
| Compound Name | 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol |
|---|---|
| PubChem CID | 165175430 |
| Molecular Formula | C18H32N4O2Si |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol |
| SMILES | CC(C)(C)NCC(O)c1nccc2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H32N4O2Si/c1-18(2,3)20-12-16(23)17-14-11-21-22(15(14)7-8-19-17)13-24-9-10-25(4,5)6/h7-8,11,16,20,23H,9-10,12-13H2,1-6H3 |
| InChIKey | HVBSDMSUHXRUNM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|