About 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol
2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol (PubChem CID 165175430) has the molecular formula C18H32N4O2Si
and a molecular weight of 364.57 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol |
| PubChem CID | 165175430 |
| Molecular Formula | C18H32N4O2Si |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol |
| SMILES | CC(C)(C)NCC(O)c1nccc2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H32N4O2Si/c1-18(2,3)20-12-16(23)17-14-11-21-22(15(14)7-8-19-17)13-24-9-10-25(4,5)6/h7-8,11,16,20,23H,9-10,12-13H2,1-6H3 |
| InChIKey | HVBSDMSUHXRUNM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol?
The IUPAC name of 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol (CID 165175430) is 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol.
What is the SMILES notation for 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol?
The canonical SMILES for 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol is CC(C)(C)NCC(O)c1nccc2c1cnn2COCC[Si](C)(C)C.
What is the InChIKey of 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol?
The InChIKey is HVBSDMSUHXRUNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N4O2Si/c1-18(2,3)20-12-16(23)17-14-11-21-22(15(14)7-8-19-17)13-24-9-10-25(4,5)6/h7-8,11,16,20,23H,9-10,12-13H2,1-6H3.
What are the key properties of 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol?
2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol has a molecular weight of 364.57 g/mol, XLogP of 3.17, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]ethanol is sourced from PubChem (CID 165175430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).