C28H40N4O3Si — CID 168938393
N-[4-(2-hydroxypropan-2-yl)cyclohexyl]-4-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]benzamide (PubChem CID 168938393) has the molecular formula C28H40N4O3Si and a molecular weight of 508.74 g/mol. Its IUPAC name is N-[4-(2-hydroxypropan-2-yl)cyclohexyl]-4-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]benzamide.
| Compound Name | N-[4-(2-hydroxypropan-2-yl)cyclohexyl]-4-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]benzamide |
|---|---|
| PubChem CID | 168938393 |
| Molecular Formula | C28H40N4O3Si |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-[4-(2-hydroxypropan-2-yl)cyclohexyl]-4-[1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-4-yl]benzamide |
| SMILES | CC(C)(O)C1CCC(NC(=O)c2ccc(-c3nccc4c3cnn4COCC[Si](C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C28H40N4O3Si/c1-28(2,34)22-10-12-23(13-11-22)31-27(33)21-8-6-20(7-9-21)26-24-18-30-32(25(24)14-15-29-26)19-35-16-17-36(3,4)5/h6-9,14-15,18,22-23,34H,10-13,16-17,19H2,1-5H3,(H,31,33) |
| InChIKey | CZTNAQQHOKXLJN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|