C33H49F2N3O5Si2 — CID 66602674
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-pent-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602674) has the molecular formula C33H49F2N3O5Si2 and a molecular weight of 661.94 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-pent-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-pent-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602674 |
| Molecular Formula | C33H49F2N3O5Si2 |
| Molecular Weight | 661.94 g/mol |
| Exact Mass | 661.32 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-pent-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CCC/C=C/c1c(-c2ccc(OC(F)F)c(OC3CC3)c2)n(COCC[Si](C)(C)C)c2cnn(COCC[Si](C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C33H49F2N3O5Si2/c1-8-9-10-11-26-30-27(21-36-38(32(30)39)23-41-17-19-45(5,6)7)37(22-40-16-18-44(2,3)4)31(26)24-12-15-28(43-33(34)35)29(20-24)42-25-13-14-25/h10-12,15,20-21,25,33H,8-9,13-14,16-19,22-23H2,1-7H3/b11-10+ |
| InChIKey | ZMAXDCQSQUELRJ-ZHACJKMWSA-N |
| XLogP | 8.45 |
| TPSA | 76.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.94 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|