C25H33F2N3O5Si — CID 66602275
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(ethoxymethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602275) has the molecular formula C25H33F2N3O5Si and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(ethoxymethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(ethoxymethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602275 |
| Molecular Formula | C25H33F2N3O5Si |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(ethoxymethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CCOCc1c(-c2ccc(OC(F)F)c(OC3CC3)c2)n(COCC[Si](C)(C)C)c2cn[nH]c(=O)c12 |
| InChI | InChI=1S/C25H33F2N3O5Si/c1-5-32-14-18-22-19(13-28-29-24(22)31)30(15-33-10-11-36(2,3)4)23(18)16-6-9-20(35-25(26)27)21(12-16)34-17-7-8-17/h6,9,12-13,17,25H,5,7-8,10-11,14-15H2,1-4H3,(H,29,31) |
| InChIKey | LODCLXZWTXDXKM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|