C23H28ClF2N3O4Si — CID 66602460
3-chloro-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602460) has the molecular formula C23H28ClF2N3O4Si and a molecular weight of 512.03 g/mol. Its IUPAC name is 3-chloro-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 3-chloro-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602460 |
| Molecular Formula | C23H28ClF2N3O4Si |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 3-chloro-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(OC(F)F)c(OCC3CC3)c2)c(Cl)c2c(=O)[nH]ncc21 |
| InChI | InChI=1S/C23H28ClF2N3O4Si/c1-34(2,3)9-8-31-13-29-16-11-27-28-22(30)19(16)20(24)21(29)15-6-7-17(33-23(25)26)18(10-15)32-12-14-4-5-14/h6-7,10-11,14,23H,4-5,8-9,12-13H2,1-3H3,(H,28,30) |
| InChIKey | OMTKHBNHUXRTLJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|