C20H24N2O4 — CID 14552691
[2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohexyl]methyl benzoate (PubChem CID 14552691) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohexyl]methyl benzoate.
| Compound Name | [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohexyl]methyl benzoate |
|---|---|
| PubChem CID | 14552691 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohexyl]methyl benzoate |
| SMILES | Cc1cn(CC2CCCCC2COC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H24N2O4/c1-14-11-22(20(25)21-18(14)23)12-16-9-5-6-10-17(16)13-26-19(24)15-7-3-2-4-8-15/h2-4,7-8,11,16-17H,5-6,9-10,12-13H2,1H3,(H,21,23,25) |
| InChIKey | RFPMBDSXOVIIAP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |