C16H15N5O5 — CID 10948287
2-[[5-(1-azidoethenyl)-2,4-dioxopyrimidin-1-yl]methoxy]ethyl benzoate (PubChem CID 10948287) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-[[5-(1-azidoethenyl)-2,4-dioxopyrimidin-1-yl]methoxy]ethyl benzoate.
| Compound Name | 2-[[5-(1-azidoethenyl)-2,4-dioxopyrimidin-1-yl]methoxy]ethyl benzoate |
|---|---|
| PubChem CID | 10948287 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-[[5-(1-azidoethenyl)-2,4-dioxopyrimidin-1-yl]methoxy]ethyl benzoate |
| SMILES | C=C(N=[N+]=[N-])c1cn(COCCOC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H15N5O5/c1-11(19-20-17)13-9-21(16(24)18-14(13)22)10-25-7-8-26-15(23)12-5-3-2-4-6-12/h2-6,9H,1,7-8,10H2,(H,18,22,24) |
| InChIKey | YWOINLVYWBBEBJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|