C24H22ClN5O7 — CID 134881023
[2-[[5-(1-azido-2-chloroethyl)-2,4-dioxopyrimidin-1-yl]methoxy]-3-benzoyloxypropyl] benzoate (PubChem CID 134881023) has the molecular formula C24H22ClN5O7 and a molecular weight of 527.92 g/mol. Its IUPAC name is [2-[[5-(1-azido-2-chloroethyl)-2,4-dioxopyrimidin-1-yl]methoxy]-3-benzoyloxypropyl] benzoate.
| Compound Name | [2-[[5-(1-azido-2-chloroethyl)-2,4-dioxopyrimidin-1-yl]methoxy]-3-benzoyloxypropyl] benzoate |
|---|---|
| PubChem CID | 134881023 |
| Molecular Formula | C24H22ClN5O7 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [2-[[5-(1-azido-2-chloroethyl)-2,4-dioxopyrimidin-1-yl]methoxy]-3-benzoyloxypropyl] benzoate |
| SMILES | [N-]=[N+]=NC(CCl)c1cn(COC(COC(=O)c2ccccc2)COC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H22ClN5O7/c25-11-20(28-29-26)19-12-30(24(34)27-21(19)31)15-37-18(13-35-22(32)16-7-3-1-4-8-16)14-36-23(33)17-9-5-2-6-10-17/h1-10,12,18,20H,11,13-15H2,(H,27,31,34) |
| InChIKey | XNRBRWGPVXWYTC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|