C15H12N10O3 — CID 12926783
2-[(2,6-diazidopurin-9-yl)methoxy]ethyl benzoate (PubChem CID 12926783) has the molecular formula C15H12N10O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is 2-[(2,6-diazidopurin-9-yl)methoxy]ethyl benzoate.
| Compound Name | 2-[(2,6-diazidopurin-9-yl)methoxy]ethyl benzoate |
|---|---|
| PubChem CID | 12926783 |
| Molecular Formula | C15H12N10O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[(2,6-diazidopurin-9-yl)methoxy]ethyl benzoate |
| SMILES | [N-]=[N+]=Nc1nc(N=[N+]=[N-])c2ncn(COCCOC(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C15H12N10O3/c16-23-21-12-11-13(20-15(19-12)22-24-17)25(8-18-11)9-27-6-7-28-14(26)10-4-2-1-3-5-10/h1-5,8H,6-7,9H2 |
| InChIKey | ZLSUXFCQKHOZIN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 176.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|