C17H17N5O4 — CID 150182622
[[9-(2-hydroxyethyl)-2-methylpurine-6-carbonyl]amino]methyl benzoate (PubChem CID 150182622) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is [[9-(2-hydroxyethyl)-2-methylpurine-6-carbonyl]amino]methyl benzoate.
| Compound Name | [[9-(2-hydroxyethyl)-2-methylpurine-6-carbonyl]amino]methyl benzoate |
|---|---|
| PubChem CID | 150182622 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [[9-(2-hydroxyethyl)-2-methylpurine-6-carbonyl]amino]methyl benzoate |
| SMILES | Cc1nc(C(=O)NCOC(=O)c2ccccc2)c2ncn(CCO)c2n1 |
| InChI | InChI=1S/C17H17N5O4/c1-11-20-14(13-15(21-11)22(7-8-23)9-18-13)16(24)19-10-26-17(25)12-5-3-2-4-6-12/h2-6,9,23H,7-8,10H2,1H3,(H,19,24) |
| InChIKey | FLTDUZLXKNAENP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|