About [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide
[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide (PubChem CID 138705862) has the molecular formula C15H15IN2O3
and a molecular weight of 398.20 g/mol. Its IUPAC name is [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide.
Molecular Properties
| Compound Name | [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide |
| PubChem CID | 138705862 |
| Molecular Formula | C15H15IN2O3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide |
| SMILES | C[n+]1cccc(C(=O)NCOC(=O)c2ccccc2)c1.[I-] |
| InChI | InChI=1S/C15H14N2O3.HI/c1-17-9-5-8-13(10-17)14(18)16-11-20-15(19)12-6-3-2-4-7-12;/h2-10H,11H2,1H3;1H |
| InChIKey | MYHPZEPJJZJYGX-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide?
The IUPAC name of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide (CID 138705862) is [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide.
What is the SMILES notation for [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide?
The canonical SMILES for [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide is C[n+]1cccc(C(=O)NCOC(=O)c2ccccc2)c1.[I-].
What is the InChIKey of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide?
The InChIKey is MYHPZEPJJZJYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3.HI/c1-17-9-5-8-13(10-17)14(18)16-11-20-15(19)12-6-3-2-4-7-12;/h2-10H,11H2,1H3;1H.
What are the key properties of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide?
[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide has a molecular weight of 398.20 g/mol, XLogP of -1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl benzoate iodide is sourced from PubChem (CID 138705862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).