C25H27N2O3+ — CID 59745063
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 59745063) has the molecular formula C25H27N2O3+ and a molecular weight of 403.50 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-methylpyridin-1-ium-3-carboxylate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-methylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 59745063 |
| Molecular Formula | C25H27N2O3+ |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | C[n+]1cccc(C(=O)ONC(=O)Cc2ccc(CCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-27-17-7-12-23(19-27)25(29)30-26-24(28)18-22-15-13-21(14-16-22)11-6-5-10-20-8-3-2-4-9-20/h2-4,7-9,12-17,19H,5-6,10-11,18H2,1H3/p+1 |
| InChIKey | CISBLGSFVXKNPF-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|