About methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate
methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 159733455) has the molecular formula C23H26NO4+
and a molecular weight of 380.46 g/mol. Its IUPAC name is methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate.
Molecular Properties
| Compound Name | methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate |
| PubChem CID | 159733455 |
| Molecular Formula | C23H26NO4+ |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | C.C[n+]1cccc(C(=O)OCCCOc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H22NO4.CH4/c1-23-14-5-7-18(17-23)22(24)26-16-6-15-25-19-10-12-21(13-11-19)27-20-8-3-2-4-9-20;/h2-5,7-14,17H,6,15-16H2,1H3;1H4/q+1; |
| InChIKey | LJNPPBWNAINPQD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate?
The IUPAC name of methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate (CID 159733455) is methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate.
What is the SMILES notation for methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate?
The canonical SMILES for methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate is C.C[n+]1cccc(C(=O)OCCCOc2ccc(Oc3ccccc3)cc2)c1.
What is the InChIKey of methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate?
The InChIKey is LJNPPBWNAINPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22NO4.CH4/c1-23-14-5-7-18(17-23)22(24)26-16-6-15-25-19-10-12-21(13-11-19)27-20-8-3-2-4-9-20;/h2-5,7-14,17H,6,15-16H2,1H3;1H4/q+1;.
What are the key properties of methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate?
methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate has a molecular weight of 380.46 g/mol, XLogP of 4.57, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-(4-phenoxyphenoxy)propyl 1-methylpyridin-1-ium-3-carboxylate is sourced from PubChem (CID 159733455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).