C21H25N2O3+ — CID 11762565
5-(5-methoxyindol-1-yl)pentyl 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 11762565) has the molecular formula C21H25N2O3+ and a molecular weight of 353.44 g/mol. Its IUPAC name is 5-(5-methoxyindol-1-yl)pentyl 1-methylpyridin-1-ium-3-carboxylate.
| Compound Name | 5-(5-methoxyindol-1-yl)pentyl 1-methylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 11762565 |
| Molecular Formula | C21H25N2O3+ |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 5-(5-methoxyindol-1-yl)pentyl 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | COc1ccc2c(ccn2CCCCCOC(=O)c2ccc[n+](C)c2)c1 |
| InChI | InChI=1S/C21H25N2O3/c1-22-11-6-7-18(16-22)21(24)26-14-5-3-4-12-23-13-10-17-15-19(25-2)8-9-20(17)23/h6-11,13,15-16H,3-5,12,14H2,1-2H3/q+1 |
| InChIKey | MZYVCFNEMXQDPC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|