C22H27N2O3+ — CID 10918029
6-(5-methoxyindol-1-yl)hexyl 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 10918029) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is 6-(5-methoxyindol-1-yl)hexyl 1-methylpyridin-1-ium-3-carboxylate.
| Compound Name | 6-(5-methoxyindol-1-yl)hexyl 1-methylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 10918029 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 6-(5-methoxyindol-1-yl)hexyl 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | COc1ccc2c(ccn2CCCCCCOC(=O)c2ccc[n+](C)c2)c1 |
| InChI | InChI=1S/C22H27N2O3/c1-23-12-7-8-19(17-23)22(25)27-15-6-4-3-5-13-24-14-11-18-16-20(26-2)9-10-21(18)24/h7-12,14,16-17H,3-6,13,15H2,1-2H3/q+1 |
| InChIKey | AEXKSPQEJVEBJC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|