About (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide
(5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide (PubChem CID 158877239) has the molecular formula C16H15N3O4
and a molecular weight of 315.32 g/mol. Its IUPAC name is (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide.
Molecular Properties
| Compound Name | (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide |
| PubChem CID | 158877239 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide |
| SMILES | C[n+]1cccc(C(=O)OCn2ccc3cc([N+](=O)[O-])ccc32)c1.[3H-] |
| InChI | InChI=1S/C16H14N3O4.H/c1-17-7-2-3-13(10-17)16(20)23-11-18-8-6-12-9-14(19(21)22)4-5-15(12)18;/h2-10H,11H2,1H3;/q+1;-1/i;1+2 |
| InChIKey | JCOZQROGAGMSIY-NLQOEHMXSA-N |
| XLogP | 2.30 |
| TPSA | 78.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide?
The IUPAC name of (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide (CID 158877239) is (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide.
What is the SMILES notation for (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide?
The canonical SMILES for (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide is C[n+]1cccc(C(=O)OCn2ccc3cc([N+](=O)[O-])ccc32)c1.[3H-].
What is the InChIKey of (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide?
The InChIKey is JCOZQROGAGMSIY-NLQOEHMXSA-N. The full InChI is InChI=1S/C16H14N3O4.H/c1-17-7-2-3-13(10-17)16(20)23-11-18-8-6-12-9-14(19(21)22)4-5-15(12)18;/h2-10H,11H2,1H3;/q+1;-1/i;1+2.
What are the key properties of (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide?
(5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide has a molecular weight of 315.32 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-nitroindol-1-yl)methyl 1-methylpyridin-1-ium-3-carboxylate;tritide is sourced from PubChem (CID 158877239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).