C24H30N3O4+ — CID 10940612
trimethyl-[3-[6-(5-nitroindol-1-yl)hexoxycarbonyl]phenyl]azanium (PubChem CID 10940612) has the molecular formula C24H30N3O4+ and a molecular weight of 424.52 g/mol. Its IUPAC name is trimethyl-[3-[6-(5-nitroindol-1-yl)hexoxycarbonyl]phenyl]azanium.
| Compound Name | trimethyl-[3-[6-(5-nitroindol-1-yl)hexoxycarbonyl]phenyl]azanium |
|---|---|
| PubChem CID | 10940612 |
| Molecular Formula | C24H30N3O4+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | trimethyl-[3-[6-(5-nitroindol-1-yl)hexoxycarbonyl]phenyl]azanium |
| SMILES | C[N+](C)(C)c1cccc(C(=O)OCCCCCCn2ccc3cc([N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C24H30N3O4/c1-27(2,3)22-10-8-9-20(18-22)24(28)31-16-7-5-4-6-14-25-15-13-19-17-21(26(29)30)11-12-23(19)25/h8-13,15,17-18H,4-7,14,16H2,1-3H3/q+1 |
| InChIKey | NRFHAMMRDIPQKX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|