C32H39N2O3+ — CID 10995751
trimethyl-[4-[7-(5-phenylmethoxyindol-1-yl)heptoxycarbonyl]phenyl]azanium (PubChem CID 10995751) has the molecular formula C32H39N2O3+ and a molecular weight of 499.68 g/mol. Its IUPAC name is trimethyl-[4-[7-(5-phenylmethoxyindol-1-yl)heptoxycarbonyl]phenyl]azanium.
| Compound Name | trimethyl-[4-[7-(5-phenylmethoxyindol-1-yl)heptoxycarbonyl]phenyl]azanium |
|---|---|
| PubChem CID | 10995751 |
| Molecular Formula | C32H39N2O3+ |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | trimethyl-[4-[7-(5-phenylmethoxyindol-1-yl)heptoxycarbonyl]phenyl]azanium |
| SMILES | C[N+](C)(C)c1ccc(C(=O)OCCCCCCCn2ccc3cc(OCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C32H39N2O3/c1-34(2,3)29-16-14-27(15-17-29)32(35)36-23-11-6-4-5-10-21-33-22-20-28-24-30(18-19-31(28)33)37-25-26-12-8-7-9-13-26/h7-9,12-20,22,24H,4-6,10-11,21,23,25H2,1-3H3/q+1 |
| InChIKey | LDWPCKIXYZVUNE-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|