C28H34INO4 — CID 11671438
8-(2-phenylmethoxyphenoxy)octyl 1-methylpyridin-1-ium-3-carboxylate iodide (PubChem CID 11671438) has the molecular formula C28H34INO4 and a molecular weight of 575.49 g/mol. Its IUPAC name is 8-(2-phenylmethoxyphenoxy)octyl 1-methylpyridin-1-ium-3-carboxylate iodide.
| Compound Name | 8-(2-phenylmethoxyphenoxy)octyl 1-methylpyridin-1-ium-3-carboxylate iodide |
|---|---|
| PubChem CID | 11671438 |
| Molecular Formula | C28H34INO4 |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 8-(2-phenylmethoxyphenoxy)octyl 1-methylpyridin-1-ium-3-carboxylate iodide |
| SMILES | C[n+]1cccc(C(=O)OCCCCCCCCOc2ccccc2OCc2ccccc2)c1.[I-] |
| InChI | InChI=1S/C28H34NO4.HI/c1-29-19-13-16-25(22-29)28(30)32-21-12-5-3-2-4-11-20-31-26-17-9-10-18-27(26)33-23-24-14-7-6-8-15-24;/h6-10,13-19,22H,2-5,11-12,20-21,23H2,1H3;1H/q+1;/p-1 |
| InChIKey | BBFYGHUFVFINSV-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|