C11H16N3O3+ — CID 19829104
2-(2-amino-2-iminoethoxy)ethyl 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 19829104) has the molecular formula C11H16N3O3+ and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-(2-amino-2-iminoethoxy)ethyl 1-methylpyridin-1-ium-3-carboxylate.
| Compound Name | 2-(2-amino-2-iminoethoxy)ethyl 1-methylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 19829104 |
| Molecular Formula | C11H16N3O3+ |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(2-amino-2-iminoethoxy)ethyl 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | [H]/N=C(\N)COCCOC(=O)c1ccc[n+](C)c1 |
| InChI | InChI=1S/C11H16N3O3/c1-14-4-2-3-9(7-14)11(15)17-6-5-16-8-10(12)13/h2-4,7H,5-6,8H2,1H3,(H3,12,13)/q+1 |
| InChIKey | ZGVHFMXEHYLSQX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|