C29H31IN2O5 — CID 11664454
8-[4-(1,3-dioxoisoindol-2-yl)phenoxy]octyl 1-methylpyridin-1-ium-3-carboxylate iodide (PubChem CID 11664454) has the molecular formula C29H31IN2O5 and a molecular weight of 614.48 g/mol. Its IUPAC name is 8-[4-(1,3-dioxoisoindol-2-yl)phenoxy]octyl 1-methylpyridin-1-ium-3-carboxylate iodide.
| Compound Name | 8-[4-(1,3-dioxoisoindol-2-yl)phenoxy]octyl 1-methylpyridin-1-ium-3-carboxylate iodide |
|---|---|
| PubChem CID | 11664454 |
| Molecular Formula | C29H31IN2O5 |
| Molecular Weight | 614.48 g/mol |
| Exact Mass | 614.13 |
| IUPAC Name | 8-[4-(1,3-dioxoisoindol-2-yl)phenoxy]octyl 1-methylpyridin-1-ium-3-carboxylate iodide |
| SMILES | C[n+]1cccc(C(=O)OCCCCCCCCOc2ccc(N3C(=O)c4ccccc4C3=O)cc2)c1.[I-] |
| InChI | InChI=1S/C29H31N2O5.HI/c1-30-18-10-11-22(21-30)29(34)36-20-9-5-3-2-4-8-19-35-24-16-14-23(15-17-24)31-27(32)25-12-6-7-13-26(25)28(31)33;/h6-7,10-18,21H,2-5,8-9,19-20H2,1H3;1H/q+1;/p-1 |
| InChIKey | CXNSSXYCMCJGJQ-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|